C26H31NO7 — CID 155514496
(2R,3R,4S)-2-[(1R,2R)-1,2-dihydroxy-3-(4-phenylphenyl)propyl]-4-hydroxy-3-(pentanoylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 155514496) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is (2R,3R,4S)-2-[(1R,2R)-1,2-dihydroxy-3-(4-phenylphenyl)propyl]-4-hydroxy-3-(pentanoylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-2-[(1R,2R)-1,2-dihydroxy-3-(4-phenylphenyl)propyl]-4-hydroxy-3-(pentanoylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 155514496 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | (2R,3R,4S)-2-[(1R,2R)-1,2-dihydroxy-3-(4-phenylphenyl)propyl]-4-hydroxy-3-(pentanoylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCCC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)Cc2ccc(-c3ccccc3)cc2)OC(C(=O)O)=C[C@@H]1O |
| InChI | InChI=1S/C26H31NO7/c1-2-3-9-22(30)27-23-19(28)15-21(26(32)33)34-25(23)24(31)20(29)14-16-10-12-18(13-11-16)17-7-5-4-6-8-17/h4-8,10-13,15,19-20,23-25,28-29,31H,2-3,9,14H2,1H3,(H,27,30)(H,32,33)/t19-,20+,23+,24+,25+/m0/s1 |
| InChIKey | ZOXNYSXLQIMQCW-CSTDLZQWSA-N |
| XLogP | 2.02 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |