C16H27NO8 — CID 158667811
(3R)-3-(heptanoylamino)-4-hydroxy-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 158667811) has the molecular formula C16H27NO8 and a molecular weight of 361.39 g/mol. Its IUPAC name is (3R)-3-(heptanoylamino)-4-hydroxy-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (3R)-3-(heptanoylamino)-4-hydroxy-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 158667811 |
| Molecular Formula | C16H27NO8 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (3R)-3-(heptanoylamino)-4-hydroxy-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCCCCC(=O)N[C@@H]1C(O)C=C(C(=O)O)OC1C(O)C(O)CO |
| InChI | InChI=1S/C16H27NO8/c1-2-3-4-5-6-12(21)17-13-9(19)7-11(16(23)24)25-15(13)14(22)10(20)8-18/h7,9-10,13-15,18-20,22H,2-6,8H2,1H3,(H,17,21)(H,23,24)/t9?,10?,13-,14?,15?/m1/s1 |
| InChIKey | IDORHNCYWWBDRE-BZORQXCASA-N |
| XLogP | -1.12 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|