C11H16NNaO8 — CID 175683869
sodium N-[(2R,3R,4S)-6-carboxy-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]ethanimidate (PubChem CID 175683869) has the molecular formula C11H16NNaO8 and a molecular weight of 313.24 g/mol. Its IUPAC name is sodium N-[(2R,3R,4S)-6-carboxy-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]ethanimidate.
| Compound Name | sodium N-[(2R,3R,4S)-6-carboxy-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]ethanimidate |
|---|---|
| PubChem CID | 175683869 |
| Molecular Formula | C11H16NNaO8 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | sodium N-[(2R,3R,4S)-6-carboxy-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]ethanimidate |
| SMILES | C/C([O-])=N\[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1O.[Na+] |
| InChI | InChI=1S/C11H17NO8.Na/c1-4(14)12-8-5(15)2-7(11(18)19)20-10(8)9(17)6(16)3-13;/h2,5-6,8-10,13,15-17H,3H2,1H3,(H,12,14)(H,18,19);/q;+1/p-1/t5-,6+,8+,9+,10+;/m0./s1 |
| InChIKey | DQNKELIJSZBCBE-VCFRRRQNSA-M |
| XLogP | -6.42 |
| TPSA | 162.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | -6.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|