C17H23NO6 — CID 158096818
N-[(3R,4R)-4-hydroxy-6-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]-2-phenylacetamide (PubChem CID 158096818) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxy-6-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]-2-phenylacetamide.
| Compound Name | N-[(3R,4R)-4-hydroxy-6-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 158096818 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(3R,4R)-4-hydroxy-6-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]-2-phenylacetamide |
| SMILES | CC1=C[C@@H](O)[C@@H](NC(=O)Cc2ccccc2)C([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C17H23NO6/c1-10-7-12(20)15(17(24-10)16(23)13(21)9-19)18-14(22)8-11-5-3-2-4-6-11/h2-7,12-13,15-17,19-21,23H,8-9H2,1H3,(H,18,22)/t12-,13-,15-,16-,17?/m1/s1 |
| InChIKey | JMVATOAKBXWVFF-VAHZBUILSA-N |
| XLogP | -0.91 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |