C17H22FN5O6S — CID 71541838
(2R,3R,4S)-4-(diaminomethylideneamino)-3-[(3-fluorophenyl)carbamothioylamino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 71541838) has the molecular formula C17H22FN5O6S and a molecular weight of 443.46 g/mol. Its IUPAC name is (2R,3R,4S)-4-(diaminomethylideneamino)-3-[(3-fluorophenyl)carbamothioylamino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-4-(diaminomethylideneamino)-3-[(3-fluorophenyl)carbamothioylamino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 71541838 |
| Molecular Formula | C17H22FN5O6S |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (2R,3R,4S)-4-(diaminomethylideneamino)-3-[(3-fluorophenyl)carbamothioylamino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | NC(N)=N[C@H]1C=C(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1NC(=S)Nc1cccc(F)c1 |
| InChI | InChI=1S/C17H22FN5O6S/c18-7-2-1-3-8(4-7)21-17(30)23-12-9(22-16(19)20)5-11(15(27)28)29-14(12)13(26)10(25)6-24/h1-5,9-10,12-14,24-26H,6H2,(H,27,28)(H4,19,20,22)(H2,21,23,30)/t9-,10+,12+,13+,14+/m0/s1 |
| InChIKey | CFDTYUFMEYOAQB-NRFQWKTPSA-N |
| XLogP | -1.80 |
| TPSA | 195.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|