C24H32N4O11 — CID 71463064
3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropyl (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 71463064) has the molecular formula C24H32N4O11 and a molecular weight of 552.54 g/mol. Its IUPAC name is 3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropyl (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | 3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropyl (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 71463064 |
| Molecular Formula | C24H32N4O11 |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropyl (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)OCCCOC(=O)/C=C/c2ccc(O)c(O)c2)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C24H32N4O11/c1-12(30)27-20-14(28-24(25)26)10-18(39-22(20)21(35)17(33)11-29)23(36)38-8-2-7-37-19(34)6-4-13-3-5-15(31)16(32)9-13/h3-6,9-10,14,17,20-22,29,31-33,35H,2,7-8,11H2,1H3,(H,27,30)(H4,25,26,28)/b6-4+/t14-,17+,20+,21+,22+/m0/s1 |
| InChIKey | HTWQHGKGGXUBSB-JVUZCBKOSA-N |
| XLogP | -2.27 |
| TPSA | 256.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|