C25H30N4O8 — CID 71723923
(2R,3R,4S)-3-acetamido-4-[[amino-(3-naphthalen-2-ylpropanoylamino)methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 71723923) has the molecular formula C25H30N4O8 and a molecular weight of 514.54 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-[[amino-(3-naphthalen-2-ylpropanoylamino)methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-[[amino-(3-naphthalen-2-ylpropanoylamino)methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 71723923 |
| Molecular Formula | C25H30N4O8 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-[[amino-(3-naphthalen-2-ylpropanoylamino)methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1/N=C(\N)NC(=O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H30N4O8/c1-13(31)27-21-17(11-19(24(35)36)37-23(21)22(34)18(32)12-30)28-25(26)29-20(33)9-7-14-6-8-15-4-2-3-5-16(15)10-14/h2-6,8,10-11,17-18,21-23,30,32,34H,7,9,12H2,1H3,(H,27,31)(H,35,36)(H3,26,28,29,33)/t17-,18+,21+,22+,23+/m0/s1 |
| InChIKey | IHPTULLORQKLHD-DYGHIYBASA-N |
| XLogP | -0.84 |
| TPSA | 203.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|