C18H18F3NO2 — CID 134150498
(2-methyl-5-propan-2-ylphenyl) N-[4-(trifluoromethyl)phenyl]carbamate (PubChem CID 134150498) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is (2-methyl-5-propan-2-ylphenyl) N-[4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | (2-methyl-5-propan-2-ylphenyl) N-[4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 134150498 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2-methyl-5-propan-2-ylphenyl) N-[4-(trifluoromethyl)phenyl]carbamate |
| SMILES | Cc1ccc(C(C)C)cc1OC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F3NO2/c1-11(2)13-5-4-12(3)16(10-13)24-17(23)22-15-8-6-14(7-9-15)18(19,20)21/h4-11H,1-3H3,(H,22,23) |
| InChIKey | MITNTXQVBYKQIQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |