C29H27BrO5 — CID 134150733
(1E,4E)-1-(3-bromo-4-methoxyphenyl)-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]penta-1,4-dien-3-one (PubChem CID 134150733) has the molecular formula C29H27BrO5 and a molecular weight of 535.43 g/mol. Its IUPAC name is (1E,4E)-1-(3-bromo-4-methoxyphenyl)-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(3-bromo-4-methoxyphenyl)-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 134150733 |
| Molecular Formula | C29H27BrO5 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | (1E,4E)-1-(3-bromo-4-methoxyphenyl)-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]penta-1,4-dien-3-one |
| SMILES | COc1ccc(/C=C/c2cc(OC)cc(OC)c2/C=C/C(=O)/C=C/c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C29H27BrO5/c1-32-24-13-7-20(8-14-24)5-10-22-18-25(33-2)19-29(35-4)26(22)15-12-23(31)11-6-21-9-16-28(34-3)27(30)17-21/h5-19H,1-4H3/b10-5+,11-6+,15-12+ |
| InChIKey | JJCUWFKOIAHRMS-RVNBITLMSA-N |
| XLogP | 6.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|