C27H38ClN3 — CID 134153008
N'-[(1S,13S)-7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl]decane-1,10-diamine (PubChem CID 134153008) has the molecular formula C27H38ClN3 and a molecular weight of 440.08 g/mol. Its IUPAC name is N'-[(1S,13S)-7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl]decane-1,10-diamine.
| Compound Name | N'-[(1S,13S)-7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl]decane-1,10-diamine |
|---|---|
| PubChem CID | 134153008 |
| Molecular Formula | C27H38ClN3 |
| Molecular Weight | 440.08 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | N'-[(1S,13S)-7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl]decane-1,10-diamine |
| SMILES | CC1=C[C@@H]2Cc3nc4cc(Cl)ccc4c(NCCCCCCCCCCN)c3[C@H](C1)C2 |
| InChI | InChI=1S/C27H38ClN3/c1-19-14-20-16-21(15-19)26-25(17-20)31-24-18-22(28)10-11-23(24)27(26)30-13-9-7-5-3-2-4-6-8-12-29/h10-11,14,18,20-21H,2-9,12-13,15-17,29H2,1H3,(H,30,31)/t20-,21+/m0/s1 |
| InChIKey | UCARJJOJVHYGLW-LEWJYISDSA-N |
| XLogP | 7.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.08 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|