C23H30N2 — CID 51040439
(1S,13S)-N-hexyl-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine (PubChem CID 51040439) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol. Its IUPAC name is (1S,13S)-N-hexyl-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine.
| Compound Name | (1S,13S)-N-hexyl-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine |
|---|---|
| PubChem CID | 51040439 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (1S,13S)-N-hexyl-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine |
| SMILES | CCCCCCNc1c2c(nc3ccccc13)C[C@H]1C=C(C)C[C@@H]2C1 |
| InChI | InChI=1S/C23H30N2/c1-3-4-5-8-11-24-23-19-9-6-7-10-20(19)25-21-15-17-12-16(2)13-18(14-17)22(21)23/h6-7,9-10,12,17-18H,3-5,8,11,13-15H2,1-2H3,(H,24,25)/t17-,18+/m0/s1 |
| InChIKey | KJQPTFFGTCXABW-ZWKOTPCHSA-N |
| XLogP | 6.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|