C23H37NO — CID 134153181
(3R,8R,9S,10S,13S,14S,17E)-3-(ethylamino)-17-ethylidene-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one (PubChem CID 134153181) has the molecular formula C23H37NO and a molecular weight of 343.56 g/mol. Its IUPAC name is (3R,8R,9S,10S,13S,14S,17E)-3-(ethylamino)-17-ethylidene-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one.
| Compound Name | (3R,8R,9S,10S,13S,14S,17E)-3-(ethylamino)-17-ethylidene-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 134153181 |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | (3R,8R,9S,10S,13S,14S,17E)-3-(ethylamino)-17-ethylidene-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one |
| SMILES | C/C=C1/C(=O)C[C@H]2[C@@H]3CCC4C[C@H](NCC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H37NO/c1-5-18-21(25)14-20-17-8-7-15-13-16(24-6-2)9-11-22(15,3)19(17)10-12-23(18,20)4/h5,15-17,19-20,24H,6-14H2,1-4H3/b18-5-/t15?,16-,17-,19+,20+,22+,23-/m1/s1 |
| InChIKey | IEELCBIFRYGDQH-SRJKJOPBSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|