C26H27N5O6 — CID 134155626
2-(2,4-dinitrophenyl)-1-[morpholin-4-yl(phenyl)methyl]-5-phenylpyrazolidin-3-ol (PubChem CID 134155626) has the molecular formula C26H27N5O6 and a molecular weight of 505.53 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-1-[morpholin-4-yl(phenyl)methyl]-5-phenylpyrazolidin-3-ol.
| Compound Name | 2-(2,4-dinitrophenyl)-1-[morpholin-4-yl(phenyl)methyl]-5-phenylpyrazolidin-3-ol |
|---|---|
| PubChem CID | 134155626 |
| Molecular Formula | C26H27N5O6 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-1-[morpholin-4-yl(phenyl)methyl]-5-phenylpyrazolidin-3-ol |
| SMILES | O=[N+]([O-])c1ccc(N2C(O)CC(c3ccccc3)N2C(c2ccccc2)N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H27N5O6/c32-25-18-23(19-7-3-1-4-8-19)29(26(20-9-5-2-6-10-20)27-13-15-37-16-14-27)28(25)22-12-11-21(30(33)34)17-24(22)31(35)36/h1-12,17,23,25-26,32H,13-16,18H2 |
| InChIKey | LRNYBFUDKFHGJW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|