C23H24N6O6S — CID 134138046
2-(2,4-dinitrophenyl)-1-[morpholin-4-yl(1,3-thiazol-5-yl)methyl]-5-phenylpyrazolidin-3-ol (PubChem CID 134138046) has the molecular formula C23H24N6O6S and a molecular weight of 512.55 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-1-[morpholin-4-yl(1,3-thiazol-5-yl)methyl]-5-phenylpyrazolidin-3-ol.
| Compound Name | 2-(2,4-dinitrophenyl)-1-[morpholin-4-yl(1,3-thiazol-5-yl)methyl]-5-phenylpyrazolidin-3-ol |
|---|---|
| PubChem CID | 134138046 |
| Molecular Formula | C23H24N6O6S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-1-[morpholin-4-yl(1,3-thiazol-5-yl)methyl]-5-phenylpyrazolidin-3-ol |
| SMILES | O=[N+]([O-])c1ccc(N2C(O)CC(c3ccccc3)N2C(c2cncs2)N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H24N6O6S/c30-22-13-19(16-4-2-1-3-5-16)27(23(21-14-24-15-36-21)25-8-10-35-11-9-25)26(22)18-7-6-17(28(31)32)12-20(18)29(33)34/h1-7,12,14-15,19,22-23,30H,8-11,13H2 |
| InChIKey | UBEPXRNJSYGPJM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 138.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|