C10H11FN2O6S — CID 134157558
(2S)-2-amino-3-[(4-fluorophenyl)sulfonylamino]butanedioic acid (PubChem CID 134157558) has the molecular formula C10H11FN2O6S and a molecular weight of 306.27 g/mol. Its IUPAC name is (2S)-2-amino-3-[(4-fluorophenyl)sulfonylamino]butanedioic acid.
| Compound Name | (2S)-2-amino-3-[(4-fluorophenyl)sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 134157558 |
| Molecular Formula | C10H11FN2O6S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (2S)-2-amino-3-[(4-fluorophenyl)sulfonylamino]butanedioic acid |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)NC([C@@H](C(=O)O)N)C(=O)O |
| InChI | InChI=1S/C10H11FN2O6S/c11-5-1-3-6(4-2-5)20(18,19)13-8(10(16)17)7(12)9(14)15/h1-4,7-8,13H,12H2,(H,14,15)(H,16,17)/t7-,8?/m0/s1 |
| InChIKey | SHOWNKVGAYTRRR-JAMMHHFISA-N |
| XLogP | -3.00 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 469 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |