C9H10N4 — CID 134158929
2,4,7,10-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,10,12-tetraene (PubChem CID 134158929) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 2,4,7,10-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,10,12-tetraene.
| Compound Name | 2,4,7,10-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,10,12-tetraene |
|---|---|
| PubChem CID | 134158929 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2,4,7,10-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,10,12-tetraene |
| SMILES | c1cnc2c(c1)NC1=NCCN1C2 |
| InChI | InChI=1S/C9H10N4/c1-2-7-8(10-3-1)6-13-5-4-11-9(13)12-7/h1-3H,4-6H2,(H,11,12) |
| InChIKey | SXSAGOBDZJOSPL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |