C15H13N3O3 — CID 123693373
(2-oxo-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepin-4-yl) benzoate (PubChem CID 123693373) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is (2-oxo-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepin-4-yl) benzoate.
| Compound Name | (2-oxo-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepin-4-yl) benzoate |
|---|---|
| PubChem CID | 123693373 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2-oxo-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepin-4-yl) benzoate |
| SMILES | O=C1CN(OC(=O)c2ccccc2)Cc2ncccc2N1 |
| InChI | InChI=1S/C15H13N3O3/c19-14-10-18(9-13-12(17-14)7-4-8-16-13)21-15(20)11-5-2-1-3-6-11/h1-8H,9-10H2,(H,17,19) |
| InChIKey | QKDPIBUAHTZYDW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |