C8H9N3O2 — CID 176828286
4-aminooxy-1,3-dihydroquinoxalin-2-one (PubChem CID 176828286) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 4-aminooxy-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-aminooxy-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 176828286 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4-aminooxy-1,3-dihydroquinoxalin-2-one |
| SMILES | NON1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C8H9N3O2/c9-13-11-5-8(12)10-6-3-1-2-4-7(6)11/h1-4H,5,9H2,(H,10,12) |
| InChIKey | PKGUZYBULMXVQY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|