C11H12N6O2 — CID 134162879
5-(azidomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]furan-2-carboxamide (PubChem CID 134162879) has the molecular formula C11H12N6O2 and a molecular weight of 260.26 g/mol. Its IUPAC name is 5-(azidomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]furan-2-carboxamide.
| Compound Name | 5-(azidomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134162879 |
| Molecular Formula | C11H12N6O2 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-(azidomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]furan-2-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccc(C(=O)NCCc2cnc[nH]2)o1 |
| InChI | InChI=1S/C11H12N6O2/c12-17-16-6-9-1-2-10(19-9)11(18)14-4-3-8-5-13-7-15-8/h1-2,5,7H,3-4,6H2,(H,13,15)(H,14,18) |
| InChIKey | IVBVJBXNFMRVSH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|