C14H12N4O3S — CID 134163009
5-(azidomethyl)-N-(1,3-benzodioxol-5-ylmethyl)thiophene-2-carboxamide (PubChem CID 134163009) has the molecular formula C14H12N4O3S and a molecular weight of 316.34 g/mol. Its IUPAC name is 5-(azidomethyl)-N-(1,3-benzodioxol-5-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 5-(azidomethyl)-N-(1,3-benzodioxol-5-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 134163009 |
| Molecular Formula | C14H12N4O3S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 5-(azidomethyl)-N-(1,3-benzodioxol-5-ylmethyl)thiophene-2-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccc(C(=O)NCc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C14H12N4O3S/c15-18-17-7-10-2-4-13(22-10)14(19)16-6-9-1-3-11-12(5-9)21-8-20-11/h1-5H,6-8H2,(H,16,19) |
| InChIKey | IPJFZWZDIFGFHR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|