C20H18N2O5S2 — CID 134164682
N-(1-ethyl-2-oxobenzo[cd]indol-6-yl)-3-methylsulfonylbenzenesulfonamide (PubChem CID 134164682) has the molecular formula C20H18N2O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-(1-ethyl-2-oxobenzo[cd]indol-6-yl)-3-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(1-ethyl-2-oxobenzo[cd]indol-6-yl)-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 134164682 |
| Molecular Formula | C20H18N2O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | N-(1-ethyl-2-oxobenzo[cd]indol-6-yl)-3-methylsulfonylbenzenesulfonamide |
| SMILES | CCN1C(=O)c2cccc3c(NS(=O)(=O)c4cccc(S(C)(=O)=O)c4)ccc1c23 |
| InChI | InChI=1S/C20H18N2O5S2/c1-3-22-18-11-10-17(15-8-5-9-16(19(15)18)20(22)23)21-29(26,27)14-7-4-6-13(12-14)28(2,24)25/h4-12,21H,3H2,1-2H3 |
| InChIKey | ZAMWFZZEDWXJPI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |