C15H19Cl2N3 — CID 134170538
1-(2,6-dichloropyrimidin-4-yl)cyclodecane-1-carbonitrile (PubChem CID 134170538) has the molecular formula C15H19Cl2N3 and a molecular weight of 312.24 g/mol. Its IUPAC name is 1-(2,6-dichloropyrimidin-4-yl)cyclodecane-1-carbonitrile.
| Compound Name | 1-(2,6-dichloropyrimidin-4-yl)cyclodecane-1-carbonitrile |
|---|---|
| PubChem CID | 134170538 |
| Molecular Formula | C15H19Cl2N3 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-(2,6-dichloropyrimidin-4-yl)cyclodecane-1-carbonitrile |
| SMILES | N#CC1(c2cc(Cl)nc(Cl)n2)CCCCCCCCC1 |
| InChI | InChI=1S/C15H19Cl2N3/c16-13-10-12(19-14(17)20-13)15(11-18)8-6-4-2-1-3-5-7-9-15/h10H,1-9H2 |
| InChIKey | CTRMHZJOUXNWHR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |