C19H21ClO3 — CID 134172612
3-(2-chloro-6-ethoxy-4-prop-1-ynylphenyl)-4-hydroxybicyclo[3.2.1]octan-2-one (PubChem CID 134172612) has the molecular formula C19H21ClO3 and a molecular weight of 332.83 g/mol. Its IUPAC name is 3-(2-chloro-6-ethoxy-4-prop-1-ynylphenyl)-4-hydroxybicyclo[3.2.1]octan-2-one.
| Compound Name | 3-(2-chloro-6-ethoxy-4-prop-1-ynylphenyl)-4-hydroxybicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 134172612 |
| Molecular Formula | C19H21ClO3 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-(2-chloro-6-ethoxy-4-prop-1-ynylphenyl)-4-hydroxybicyclo[3.2.1]octan-2-one |
| SMILES | CC#Cc1cc(Cl)c(C2C(=O)C3CCC(C3)C2O)c(OCC)c1 |
| InChI | InChI=1S/C19H21ClO3/c1-3-5-11-8-14(20)16(15(9-11)23-4-2)17-18(21)12-6-7-13(10-12)19(17)22/h8-9,12-13,17-18,21H,4,6-7,10H2,1-2H3 |
| InChIKey | NXLPEWILUSKEMP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|