C16H17FN2O3 — CID 123836456
4-(2-ethoxy-6-fluoro-4-prop-1-ynylphenyl)-5-hydroxy-1,2-dimethylpyrazol-3-one (PubChem CID 123836456) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is 4-(2-ethoxy-6-fluoro-4-prop-1-ynylphenyl)-5-hydroxy-1,2-dimethylpyrazol-3-one.
| Compound Name | 4-(2-ethoxy-6-fluoro-4-prop-1-ynylphenyl)-5-hydroxy-1,2-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 123836456 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-(2-ethoxy-6-fluoro-4-prop-1-ynylphenyl)-5-hydroxy-1,2-dimethylpyrazol-3-one |
| SMILES | CC#Cc1cc(F)c(-c2c(O)n(C)n(C)c2=O)c(OCC)c1 |
| InChI | InChI=1S/C16H17FN2O3/c1-5-7-10-8-11(17)13(12(9-10)22-6-2)14-15(20)18(3)19(4)16(14)21/h8-9,20H,6H2,1-4H3 |
| InChIKey | FQCGSXQUUHZQGL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|