C16H20O5 — CID 64534568
methyl 3-(3,4,5-triethoxyphenyl)prop-2-ynoate (PubChem CID 64534568) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is methyl 3-(3,4,5-triethoxyphenyl)prop-2-ynoate.
| Compound Name | methyl 3-(3,4,5-triethoxyphenyl)prop-2-ynoate |
|---|---|
| PubChem CID | 64534568 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | methyl 3-(3,4,5-triethoxyphenyl)prop-2-ynoate |
| SMILES | CCOc1cc(C#CC(=O)OC)cc(OCC)c1OCC |
| InChI | InChI=1S/C16H20O5/c1-5-19-13-10-12(8-9-15(17)18-4)11-14(20-6-2)16(13)21-7-3/h10-11H,5-7H2,1-4H3 |
| InChIKey | KWSKZYJQBNIEEL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|