C20H26FNO2 — CID 123164405
3-amino-2-(2-ethoxy-6-fluoro-4-prop-1-ynylphenyl)-6-ethyl-4-methylcyclohexan-1-one (PubChem CID 123164405) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is 3-amino-2-(2-ethoxy-6-fluoro-4-prop-1-ynylphenyl)-6-ethyl-4-methylcyclohexan-1-one.
| Compound Name | 3-amino-2-(2-ethoxy-6-fluoro-4-prop-1-ynylphenyl)-6-ethyl-4-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 123164405 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 3-amino-2-(2-ethoxy-6-fluoro-4-prop-1-ynylphenyl)-6-ethyl-4-methylcyclohexan-1-one |
| SMILES | CC#Cc1cc(F)c(C2C(=O)C(CC)CC(C)C2N)c(OCC)c1 |
| InChI | InChI=1S/C20H26FNO2/c1-5-8-13-10-15(21)17(16(11-13)24-7-3)18-19(22)12(4)9-14(6-2)20(18)23/h10-12,14,18-19H,6-7,9,22H2,1-4H3 |
| InChIKey | UEXLCWSAELOPBX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|