C17H20BrFO4 — CID 134426705
2-[4-bromo-2-fluoro-6-(2-methoxyethoxy)phenyl]-4-ethylcyclohexane-1,3-dione (PubChem CID 134426705) has the molecular formula C17H20BrFO4 and a molecular weight of 387.25 g/mol. Its IUPAC name is 2-[4-bromo-2-fluoro-6-(2-methoxyethoxy)phenyl]-4-ethylcyclohexane-1,3-dione.
| Compound Name | 2-[4-bromo-2-fluoro-6-(2-methoxyethoxy)phenyl]-4-ethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 134426705 |
| Molecular Formula | C17H20BrFO4 |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 2-[4-bromo-2-fluoro-6-(2-methoxyethoxy)phenyl]-4-ethylcyclohexane-1,3-dione |
| SMILES | CCC1CCC(=O)C(c2c(F)cc(Br)cc2OCCOC)C1=O |
| InChI | InChI=1S/C17H20BrFO4/c1-3-10-4-5-13(20)16(17(10)21)15-12(19)8-11(18)9-14(15)23-7-6-22-2/h8-10,16H,3-7H2,1-2H3 |
| InChIKey | BBOHTXCQJMDHIG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|