C25H29F3N4O5S2 — CID 134173954
2-[(1S)-1-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)cyclohexa-1,5-dien-1-yl]ethyl]-4-(3,3,3-trifluoropropyl)-1,3-thiazole (PubChem CID 134173954) has the molecular formula C25H29F3N4O5S2 and a molecular weight of 586.66 g/mol. Its IUPAC name is 2-[(1S)-1-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)cyclohexa-1,5-dien-1-yl]ethyl]-4-(3,3,3-trifluoropropyl)-1,3-thiazole.
| Compound Name | 2-[(1S)-1-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)cyclohexa-1,5-dien-1-yl]ethyl]-4-(3,3,3-trifluoropropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 134173954 |
| Molecular Formula | C25H29F3N4O5S2 |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | 2-[(1S)-1-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)cyclohexa-1,5-dien-1-yl]ethyl]-4-(3,3,3-trifluoropropyl)-1,3-thiazole |
| SMILES | COC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC1=CCC(NS(=O)O)C=C1)c1nc(CCC(F)(F)F)cs1 |
| InChI | InChI=1S/C25H29F3N4O5S2/c1-37-24(34)31-20(13-16-5-3-2-4-6-16)22(33)30-21(14-17-7-9-18(10-8-17)32-39(35)36)23-29-19(15-38-23)11-12-25(26,27)28/h2-9,15,18,20-21,32H,10-14H2,1H3,(H,30,33)(H,31,34)(H,35,36)/t18?,20-,21-/m0/s1 |
| InChIKey | KKWSIJGQZKYHLR-LLQWEQGGSA-N |
| XLogP | 4.13 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|