C33H45F2N3O2S — CID 134174619
2-(trimethyl-λ4-sulfanyl)ethyl N-[3-[[(R)-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-cyclohexylmethyl]amino]propyl]carbamate (PubChem CID 134174619) has the molecular formula C33H45F2N3O2S and a molecular weight of 585.81 g/mol. Its IUPAC name is 2-(trimethyl-λ4-sulfanyl)ethyl N-[3-[[(R)-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-cyclohexylmethyl]amino]propyl]carbamate.
| Compound Name | 2-(trimethyl-λ4-sulfanyl)ethyl N-[3-[[(R)-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-cyclohexylmethyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 134174619 |
| Molecular Formula | C33H45F2N3O2S |
| Molecular Weight | 585.81 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | 2-(trimethyl-λ4-sulfanyl)ethyl N-[3-[[(R)-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-cyclohexylmethyl]amino]propyl]carbamate |
| SMILES | CS(C)(C)CCOC(=O)NCCCN[C@@H](c1cc(-c2cc(F)ccc2F)cn1Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C33H45F2N3O2S/c1-41(2,3)20-19-40-33(39)37-18-10-17-36-32(26-13-8-5-9-14-26)31-21-27(29-22-28(34)15-16-30(29)35)24-38(31)23-25-11-6-4-7-12-25/h4,6-7,11-12,15-16,21-22,24,26,32,36H,5,8-10,13-14,17-20,23H2,1-3H3,(H,37,39)/t32-/m1/s1 |
| InChIKey | MSQOECZCLUHVGO-JGCGQSQUSA-N |
| XLogP | 7.50 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.81 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|