C24H26F2N2 — CID 121428658
(R)-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-cyclohexylmethanamine (PubChem CID 121428658) has the molecular formula C24H26F2N2 and a molecular weight of 380.48 g/mol. Its IUPAC name is (R)-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-cyclohexylmethanamine.
| Compound Name | (R)-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-cyclohexylmethanamine |
|---|---|
| PubChem CID | 121428658 |
| Molecular Formula | C24H26F2N2 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (R)-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-cyclohexylmethanamine |
| SMILES | N[C@@H](c1cc(-c2cc(F)ccc2F)cn1Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C24H26F2N2/c25-20-11-12-22(26)21(14-20)19-13-23(24(27)18-9-5-2-6-10-18)28(16-19)15-17-7-3-1-4-8-17/h1,3-4,7-8,11-14,16,18,24H,2,5-6,9-10,15,27H2/t24-/m1/s1 |
| InChIKey | KUAIEZXVSDSBIW-XMMPIXPASA-N |
| XLogP | 6.06 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |