C24H28F2N2 — CID 175164377
azane;1-benzyl-2-(cyclohexylmethyl)-4-(2,5-difluorophenyl)pyrrole (PubChem CID 175164377) has the molecular formula C24H28F2N2 and a molecular weight of 382.50 g/mol. Its IUPAC name is azane;1-benzyl-2-(cyclohexylmethyl)-4-(2,5-difluorophenyl)pyrrole.
| Compound Name | azane;1-benzyl-2-(cyclohexylmethyl)-4-(2,5-difluorophenyl)pyrrole |
|---|---|
| PubChem CID | 175164377 |
| Molecular Formula | C24H28F2N2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | azane;1-benzyl-2-(cyclohexylmethyl)-4-(2,5-difluorophenyl)pyrrole |
| SMILES | Fc1ccc(F)c(-c2cc(CC3CCCCC3)n(Cc3ccccc3)c2)c1.N |
| InChI | InChI=1S/C24H25F2N.H3N/c25-21-11-12-24(26)23(15-21)20-14-22(13-18-7-3-1-4-8-18)27(17-20)16-19-9-5-2-6-10-19;/h2,5-6,9-12,14-15,17-18H,1,3-4,7-8,13,16H2;1H3 |
| InChIKey | YNZLNRNOIRUSFE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 39.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |