C48H33N3S2 — CID 134176006
2-[3-(12,12-dimethylindeno[2,1-a]thianthren-10-yl)-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 134176006) has the molecular formula C48H33N3S2 and a molecular weight of 715.95 g/mol. Its IUPAC name is 2-[3-(12,12-dimethylindeno[2,1-a]thianthren-10-yl)-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(12,12-dimethylindeno[2,1-a]thianthren-10-yl)-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134176006 |
| Molecular Formula | C48H33N3S2 |
| Molecular Weight | 715.95 g/mol |
| Exact Mass | 715.21 |
| IUPAC Name | 2-[3-(12,12-dimethylindeno[2,1-a]thianthren-10-yl)-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2cc(-c3cc(-c4ccccc4)cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc2-c2ccc3c(c21)Sc1ccccc1S3 |
| InChI | InChI=1S/C48H33N3S2/c1-48(2)39-29-33(22-23-37(39)38-24-25-42-44(43(38)48)53-41-21-13-12-20-40(41)52-42)35-26-34(30-14-6-3-7-15-30)27-36(28-35)47-50-45(31-16-8-4-9-17-31)49-46(51-47)32-18-10-5-11-19-32/h3-29H,1-2H3 |
| InChIKey | TXMXMKDMDZCZQA-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.95 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |