C17H11Cl2F2N3O — CID 134176532
3,5-dichloro-4-[1-[5-(2,3-difluorophenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]aniline (PubChem CID 134176532) has the molecular formula C17H11Cl2F2N3O and a molecular weight of 382.20 g/mol. Its IUPAC name is 3,5-dichloro-4-[1-[5-(2,3-difluorophenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]aniline.
| Compound Name | 3,5-dichloro-4-[1-[5-(2,3-difluorophenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]aniline |
|---|---|
| PubChem CID | 134176532 |
| Molecular Formula | C17H11Cl2F2N3O |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 3,5-dichloro-4-[1-[5-(2,3-difluorophenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]aniline |
| SMILES | Nc1cc(Cl)c(C2(c3noc(-c4cccc(F)c4F)n3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2F2N3O/c18-10-6-8(22)7-11(19)13(10)17(4-5-17)16-23-15(25-24-16)9-2-1-3-12(20)14(9)21/h1-3,6-7H,4-5,22H2 |
| InChIKey | WRYRSXNZXPVMHP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|