C9H7Cl3OS2 — CID 134176674
O-ethyl (3,4,5-trichlorophenyl)sulfanylmethanethioate (PubChem CID 134176674) has the molecular formula C9H7Cl3OS2 and a molecular weight of 301.65 g/mol. Its IUPAC name is O-ethyl (3,4,5-trichlorophenyl)sulfanylmethanethioate.
| Compound Name | O-ethyl (3,4,5-trichlorophenyl)sulfanylmethanethioate |
|---|---|
| PubChem CID | 134176674 |
| Molecular Formula | C9H7Cl3OS2 |
| Molecular Weight | 301.65 g/mol |
| Exact Mass | 299.90 |
| IUPAC Name | O-ethyl (3,4,5-trichlorophenyl)sulfanylmethanethioate |
| SMILES | CCOC(=S)Sc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H7Cl3OS2/c1-2-13-9(14)15-5-3-6(10)8(12)7(11)4-5/h3-4H,2H2,1H3 |
| InChIKey | UJAMCNLIGCWWAB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|