C13H13Cl3N2O3 — CID 134115560
ethyl (E)-3-amino-2-[(3,4,5-trichlorophenyl)carbamoyl]but-2-enoate (PubChem CID 134115560) has the molecular formula C13H13Cl3N2O3 and a molecular weight of 351.62 g/mol. Its IUPAC name is ethyl (E)-3-amino-2-[(3,4,5-trichlorophenyl)carbamoyl]but-2-enoate.
| Compound Name | ethyl (E)-3-amino-2-[(3,4,5-trichlorophenyl)carbamoyl]but-2-enoate |
|---|---|
| PubChem CID | 134115560 |
| Molecular Formula | C13H13Cl3N2O3 |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | ethyl (E)-3-amino-2-[(3,4,5-trichlorophenyl)carbamoyl]but-2-enoate |
| SMILES | CCOC(=O)/C(C(=O)Nc1cc(Cl)c(Cl)c(Cl)c1)=C(\C)N |
| InChI | InChI=1S/C13H13Cl3N2O3/c1-3-21-13(20)10(6(2)17)12(19)18-7-4-8(14)11(16)9(15)5-7/h4-5H,3,17H2,1-2H3,(H,18,19)/b10-6+ |
| InChIKey | VMWIMRFACKSUQF-UXBLZVDNSA-N |
| XLogP | 3.38 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|