C10H18IN3O — CID 134181669
trans-(1S,4S)-4-amino-3-[(E)-iodoiminomethyl]-N,N-dimethylcyclohexane-1-carboxamide (PubChem CID 134181669) has the molecular formula C10H18IN3O and a molecular weight of 323.18 g/mol. Its IUPAC name is trans-(1S,4S)-4-amino-3-[(E)-iodoiminomethyl]-N,N-dimethylcyclohexane-1-carboxamide.
| Compound Name | trans-(1S,4S)-4-amino-3-[(E)-iodoiminomethyl]-N,N-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 134181669 |
| Molecular Formula | C10H18IN3O |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | trans-(1S,4S)-4-amino-3-[(E)-iodoiminomethyl]-N,N-dimethylcyclohexane-1-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CC[C@H](N)C(/C=N/I)C1 |
| InChI | InChI=1S/C10H18IN3O/c1-14(2)10(15)7-3-4-9(12)8(5-7)6-13-11/h6-9H,3-5,12H2,1-2H3/b13-6+/t7-,8?,9-/m0/s1 |
| InChIKey | DSULRJDLMXAYNI-QRRDYAQKSA-N |
| XLogP | 1.24 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|