C16H31N3O7 — CID 56596711
(1S,3R,4R)-4-amino-3-(2,2-dimethylpropanoylamino)-N,N-dimethylcyclohexane-1-carboxamide;oxalic acid;hydrate (PubChem CID 56596711) has the molecular formula C16H31N3O7 and a molecular weight of 377.44 g/mol. Its IUPAC name is (1S,3R,4R)-4-amino-3-(2,2-dimethylpropanoylamino)-N,N-dimethylcyclohexane-1-carboxamide;oxalic acid;hydrate.
| Compound Name | (1S,3R,4R)-4-amino-3-(2,2-dimethylpropanoylamino)-N,N-dimethylcyclohexane-1-carboxamide;oxalic acid;hydrate |
|---|---|
| PubChem CID | 56596711 |
| Molecular Formula | C16H31N3O7 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (1S,3R,4R)-4-amino-3-(2,2-dimethylpropanoylamino)-N,N-dimethylcyclohexane-1-carboxamide;oxalic acid;hydrate |
| SMILES | CN(C)C(=O)[C@H]1CC[C@@H](N)[C@H](NC(=O)C(C)(C)C)C1.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H27N3O2.C2H2O4.H2O/c1-14(2,3)13(19)16-11-8-9(6-7-10(11)15)12(18)17(4)5;3-1(4)2(5)6;/h9-11H,6-8,15H2,1-5H3,(H,16,19);(H,3,4)(H,5,6);1H2/t9-,10+,11+;;/m0../s1 |
| InChIKey | SDKHDKMTPMVFGL-WOIXAISOSA-N |
| XLogP | -0.94 |
| TPSA | 181.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|