C21H21F4N5O — CID 134182715
1-[4-[4-(1-fluoro-2-methylbutyl)triazol-1-yl]phenyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 134182715) has the molecular formula C21H21F4N5O and a molecular weight of 435.43 g/mol. Its IUPAC name is 1-[4-[4-(1-fluoro-2-methylbutyl)triazol-1-yl]phenyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[4-(1-fluoro-2-methylbutyl)triazol-1-yl]phenyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 134182715 |
| Molecular Formula | C21H21F4N5O |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-[4-[4-(1-fluoro-2-methylbutyl)triazol-1-yl]phenyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CCC(C)C(F)c1cn(-c2ccc(NC(=O)Nc3ccccc3C(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C21H21F4N5O/c1-3-13(2)19(22)18-12-30(29-28-18)15-10-8-14(9-11-15)26-20(31)27-17-7-5-4-6-16(17)21(23,24)25/h4-13,19H,3H2,1-2H3,(H2,26,27,31) |
| InChIKey | MHMYZJXRRMIJCS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |