C18H20F3N2O4P — CID 87917178
butan-2-yloxy-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]phenyl]phosphinic acid (PubChem CID 87917178) has the molecular formula C18H20F3N2O4P and a molecular weight of 416.34 g/mol. Its IUPAC name is butan-2-yloxy-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]phenyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]phenyl]phosphinic acid |
|---|---|
| PubChem CID | 87917178 |
| Molecular Formula | C18H20F3N2O4P |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | butan-2-yloxy-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]phenyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)c1ccccc1NC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H20F3N2O4P/c1-3-12(2)27-28(25,26)16-11-7-6-10-15(16)23-17(24)22-14-9-5-4-8-13(14)18(19,20)21/h4-12H,3H2,1-2H3,(H,25,26)(H2,22,23,24) |
| InChIKey | IQFXCTGMZKOOMB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|