C19H28N6O4S2 — CID 134186085
2,5-diamino-4-[1-(4-amino-2-sulfamoylphenyl)piperidin-4-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 134186085) has the molecular formula C19H28N6O4S2 and a molecular weight of 468.61 g/mol. Its IUPAC name is 2,5-diamino-4-[1-(4-amino-2-sulfamoylphenyl)piperidin-4-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2,5-diamino-4-[1-(4-amino-2-sulfamoylphenyl)piperidin-4-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 134186085 |
| Molecular Formula | C19H28N6O4S2 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2,5-diamino-4-[1-(4-amino-2-sulfamoylphenyl)piperidin-4-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(N)c(C2CCN(c3ccc(N)cc3S(N)(=O)=O)CC2)cc1N |
| InChI | InChI=1S/C19H28N6O4S2/c1-24(2)31(28,29)18-11-15(21)14(10-16(18)22)12-5-7-25(8-6-12)17-4-3-13(20)9-19(17)30(23,26)27/h3-4,9-12H,5-8,20-22H2,1-2H3,(H2,23,26,27) |
| InChIKey | HMXRJSULFRAEQP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 178.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|