C13H13FINO3S — CID 134192448
(3S)-2-(4-fluorophenyl)sulfonyl-1-methyl-2-azabicyclo[2.1.1]hexane-3-carbonyl iodide (PubChem CID 134192448) has the molecular formula C13H13FINO3S and a molecular weight of 409.22 g/mol. Its IUPAC name is (3S)-2-(4-fluorophenyl)sulfonyl-1-methyl-2-azabicyclo[2.1.1]hexane-3-carbonyl iodide.
| Compound Name | (3S)-2-(4-fluorophenyl)sulfonyl-1-methyl-2-azabicyclo[2.1.1]hexane-3-carbonyl iodide |
|---|---|
| PubChem CID | 134192448 |
| Molecular Formula | C13H13FINO3S |
| Molecular Weight | 409.22 g/mol |
| Exact Mass | 408.96 |
| IUPAC Name | (3S)-2-(4-fluorophenyl)sulfonyl-1-methyl-2-azabicyclo[2.1.1]hexane-3-carbonyl iodide |
| SMILES | CC12CC(C1)[C@@H](C(=O)I)N2S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H13FINO3S/c1-13-6-8(7-13)11(12(15)17)16(13)20(18,19)10-4-2-9(14)3-5-10/h2-5,8,11H,6-7H2,1H3/t8?,11-,13?/m0/s1 |
| InChIKey | AFSCRUNOUYFCQY-SAVVLTDYSA-N |
| XLogP | 2.33 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|