C21H19FN6O3 — CID 134201672
5-[(4-fluorophenyl)methyl]-N-[(2S,5R,6R)-8-methyl-7-oxo-8,10,13-triazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-6-yl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 134201672) has the molecular formula C21H19FN6O3 and a molecular weight of 422.42 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-N-[(2S,5R,6R)-8-methyl-7-oxo-8,10,13-triazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-6-yl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-[(4-fluorophenyl)methyl]-N-[(2S,5R,6R)-8-methyl-7-oxo-8,10,13-triazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-6-yl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 134201672 |
| Molecular Formula | C21H19FN6O3 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-N-[(2S,5R,6R)-8-methyl-7-oxo-8,10,13-triazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-6-yl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CN1C(=O)[C@H](NC(=O)c2nnc(Cc3ccc(F)cc3)o2)[C@@H]2CC[C@@H]2c2nccnc21 |
| InChI | InChI=1S/C21H19FN6O3/c1-28-18-16(23-8-9-24-18)13-6-7-14(13)17(21(28)30)25-19(29)20-27-26-15(31-20)10-11-2-4-12(22)5-3-11/h2-5,8-9,13-14,17H,6-7,10H2,1H3,(H,25,29)/t13-,14+,17+/m0/s1 |
| InChIKey | PVOLKNQBEREGMY-JJRVBVJISA-N |
| XLogP | 1.86 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |