C13H28F3NO3S — CID 134206869
tetraethylazanium;5,5,5-trifluoropentane-1-sulfonate (PubChem CID 134206869) has the molecular formula C13H28F3NO3S and a molecular weight of 335.43 g/mol. Its IUPAC name is tetraethylazanium;5,5,5-trifluoropentane-1-sulfonate.
| Compound Name | tetraethylazanium;5,5,5-trifluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 134206869 |
| Molecular Formula | C13H28F3NO3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | tetraethylazanium;5,5,5-trifluoropentane-1-sulfonate |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])CCCCC(F)(F)F |
| InChI | InChI=1S/C8H20N.C5H9F3O3S/c1-5-9(6-2,7-3)8-4;6-5(7,8)3-1-2-4-12(9,10)11/h5-8H2,1-4H3;1-4H2,(H,9,10,11)/q+1;/p-1 |
| InChIKey | HAPGLOHOXLWWPN-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|