C6H8F2N2 — CID 134210252
(2R)-3,3-difluoropiperidine-2-carbonitrile (PubChem CID 134210252) has the molecular formula C6H8F2N2 and a molecular weight of 146.14 g/mol. Its IUPAC name is (2R)-3,3-difluoropiperidine-2-carbonitrile.
| Compound Name | (2R)-3,3-difluoropiperidine-2-carbonitrile |
|---|---|
| PubChem CID | 134210252 |
| Molecular Formula | C6H8F2N2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (2R)-3,3-difluoropiperidine-2-carbonitrile |
| SMILES | N#C[C@H]1NCCCC1(F)F |
| InChI | InChI=1S/C6H8F2N2/c7-6(8)2-1-3-10-5(6)4-9/h5,10H,1-3H2/t5-/m1/s1 |
| InChIKey | OSGRGXSXOZJOML-RXMQYKEDSA-N |
| XLogP | 0.90 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |