C5H2F6N2 — CID 584396
3,3-bis(trifluoromethyl)aziridine-2-carbonitrile (PubChem CID 584396) has the molecular formula C5H2F6N2 and a molecular weight of 204.07 g/mol. Its IUPAC name is 3,3-bis(trifluoromethyl)aziridine-2-carbonitrile.
| Compound Name | 3,3-bis(trifluoromethyl)aziridine-2-carbonitrile |
|---|---|
| PubChem CID | 584396 |
| Molecular Formula | C5H2F6N2 |
| Molecular Weight | 204.07 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 3,3-bis(trifluoromethyl)aziridine-2-carbonitrile |
| SMILES | N#CC1NC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F6N2/c6-4(7,8)3(5(9,10)11)2(1-12)13-3/h2,13H |
| InChIKey | FWRQUQQDTHUNSX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.07 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|