C8H8ClF6NO — CID 11878561
(1R,4R,6R,7S)-7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol (PubChem CID 11878561) has the molecular formula C8H8ClF6NO and a molecular weight of 283.60 g/mol. Its IUPAC name is (1R,4R,6R,7S)-7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol.
| Compound Name | (1R,4R,6R,7S)-7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol |
|---|---|
| PubChem CID | 11878561 |
| Molecular Formula | C8H8ClF6NO |
| Molecular Weight | 283.60 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (1R,4R,6R,7S)-7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol |
| SMILES | O[C@@H]1C[C@H]2[C@H](Cl)[C@@H]1NC2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8ClF6NO/c9-4-2-1-3(17)5(4)16-6(2,7(10,11)12)8(13,14)15/h2-5,16-17H,1H2/t2-,3+,4-,5+/m0/s1 |
| InChIKey | USSVIHRJYFGQCJ-SKNVOMKLSA-N |
| XLogP | 1.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.60 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|