C10H12ClF6NO2 — CID 4243570
2-[[7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl]oxy]ethanol (PubChem CID 4243570) has the molecular formula C10H12ClF6NO2 and a molecular weight of 327.65 g/mol. Its IUPAC name is 2-[[7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl]oxy]ethanol.
| Compound Name | 2-[[7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl]oxy]ethanol |
|---|---|
| PubChem CID | 4243570 |
| Molecular Formula | C10H12ClF6NO2 |
| Molecular Weight | 327.65 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-[[7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl]oxy]ethanol |
| SMILES | OCCOC1CC2C(Cl)C1NC2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12ClF6NO2/c11-6-4-3-5(20-2-1-19)7(6)18-8(4,9(12,13)14)10(15,16)17/h4-7,18-19H,1-3H2 |
| InChIKey | XGIKSUJJSGSNBH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.65 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|