C8H7ClF6N2O3 — CID 50937760
[(1S,4S,6R,7S)-7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl] nitrate (PubChem CID 50937760) has the molecular formula C8H7ClF6N2O3 and a molecular weight of 328.60 g/mol. Its IUPAC name is [(1S,4S,6R,7S)-7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl] nitrate.
| Compound Name | [(1S,4S,6R,7S)-7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl] nitrate |
|---|---|
| PubChem CID | 50937760 |
| Molecular Formula | C8H7ClF6N2O3 |
| Molecular Weight | 328.60 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | [(1S,4S,6R,7S)-7-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl] nitrate |
| SMILES | O=[N+]([O-])O[C@@H]1C[C@@H]2[C@H](Cl)[C@H]1NC2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7ClF6N2O3/c9-4-2-1-3(20-17(18)19)5(4)16-6(2,7(10,11)12)8(13,14)15/h2-5,16H,1H2/t2-,3-,4+,5+/m1/s1 |
| InChIKey | NDEIAEDRWXLTEG-MBMOQRBOSA-N |
| XLogP | 2.03 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.60 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|