C8H7BrClF6N — CID 609410
7-bromo-6-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptane (PubChem CID 609410) has the molecular formula C8H7BrClF6N and a molecular weight of 346.50 g/mol. Its IUPAC name is 7-bromo-6-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptane.
| Compound Name | 7-bromo-6-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 609410 |
| Molecular Formula | C8H7BrClF6N |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | 7-bromo-6-chloro-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptane |
| SMILES | FC(F)(F)C1(C(F)(F)F)NC2C(Cl)CC1C2Br |
| InChI | InChI=1S/C8H7BrClF6N/c9-4-2-1-3(10)5(4)17-6(2,7(11,12)13)8(14,15)16/h2-5,17H,1H2 |
| InChIKey | JSDWVKURFFDIKI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|