C10H10BrF6NO2 — CID 98063198
[(1S,4R,5S,6S)-5-bromo-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl] acetate (PubChem CID 98063198) has the molecular formula C10H10BrF6NO2 and a molecular weight of 370.09 g/mol. Its IUPAC name is [(1S,4R,5S,6S)-5-bromo-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl] acetate.
| Compound Name | [(1S,4R,5S,6S)-5-bromo-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl] acetate |
|---|---|
| PubChem CID | 98063198 |
| Molecular Formula | C10H10BrF6NO2 |
| Molecular Weight | 370.09 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | [(1S,4R,5S,6S)-5-bromo-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](Br)[C@@H]2C[C@@H]1NC2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10BrF6NO2/c1-3(19)20-7-5-2-4(6(7)11)8(18-5,9(12,13)14)10(15,16)17/h4-7,18H,2H2,1H3/t4-,5-,6-,7-/m0/s1 |
| InChIKey | FCKCEYSPFMHAJD-AXMZGBSTSA-N |
| XLogP | 2.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.09 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|